C11H20F3N3O2S2 — CID 83048165
1-methyl-4-(4,4,4-trifluorobutylsulfonylamino)piperidine-4-carbothioamide (PubChem CID 83048165) has the molecular formula C11H20F3N3O2S2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 1-methyl-4-(4,4,4-trifluorobutylsulfonylamino)piperidine-4-carbothioamide.
| Compound Name | 1-methyl-4-(4,4,4-trifluorobutylsulfonylamino)piperidine-4-carbothioamide |
|---|---|
| PubChem CID | 83048165 |
| Molecular Formula | C11H20F3N3O2S2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-methyl-4-(4,4,4-trifluorobutylsulfonylamino)piperidine-4-carbothioamide |
| SMILES | CN1CCC(NS(=O)(=O)CCCC(F)(F)F)(C(N)=S)CC1 |
| InChI | InChI=1S/C11H20F3N3O2S2/c1-17-6-4-10(5-7-17,9(15)20)16-21(18,19)8-2-3-11(12,13)14/h16H,2-8H2,1H3,(H2,15,20) |
| InChIKey | XAPMGWXGHWVFIA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|