About methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate
methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate (PubChem CID 83048303) has the molecular formula C12H20F3NO4S
and a molecular weight of 331.36 g/mol. Its IUPAC name is methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate.
Molecular Properties
| Compound Name | methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate |
| PubChem CID | 83048303 |
| Molecular Formula | C12H20F3NO4S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate |
| SMILES | COC(=O)CN(C1CCCC1)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H20F3NO4S/c1-20-11(17)9-16(10-5-2-3-6-10)21(18,19)8-4-7-12(13,14)15/h10H,2-9H2,1H3 |
| InChIKey | KXMGHGAHDSMAPH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate?
The IUPAC name of methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate (CID 83048303) is methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate.
What is the SMILES notation for methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate?
The canonical SMILES for methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate is COC(=O)CN(C1CCCC1)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate?
The InChIKey is KXMGHGAHDSMAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3NO4S/c1-20-11(17)9-16(10-5-2-3-6-10)21(18,19)8-4-7-12(13,14)15/h10H,2-9H2,1H3.
What are the key properties of methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate?
methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate has a molecular weight of 331.36 g/mol, XLogP of 2.08, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[cyclopentyl(4,4,4-trifluorobutylsulfonyl)amino]acetate is sourced from PubChem (CID 83048303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).