C12H21F3N2O2S2 — CID 83048428
4-methyl-1-(4,4,4-trifluorobutylsulfonylamino)cyclohexane-1-carbothioamide (PubChem CID 83048428) has the molecular formula C12H21F3N2O2S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-methyl-1-(4,4,4-trifluorobutylsulfonylamino)cyclohexane-1-carbothioamide.
| Compound Name | 4-methyl-1-(4,4,4-trifluorobutylsulfonylamino)cyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 83048428 |
| Molecular Formula | C12H21F3N2O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-methyl-1-(4,4,4-trifluorobutylsulfonylamino)cyclohexane-1-carbothioamide |
| SMILES | CC1CCC(NS(=O)(=O)CCCC(F)(F)F)(C(N)=S)CC1 |
| InChI | InChI=1S/C12H21F3N2O2S2/c1-9-3-6-11(7-4-9,10(16)20)17-21(18,19)8-2-5-12(13,14)15/h9,17H,2-8H2,1H3,(H2,16,20) |
| InChIKey | WNECHWFLASGWMF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|