C9H17N5OS — CID 83048478
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide (PubChem CID 83048478) has the molecular formula C9H17N5OS and a molecular weight of 243.34 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide |
|---|---|
| PubChem CID | 83048478 |
| Molecular Formula | C9H17N5OS |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]pentanehydrazide |
| SMILES | CCCC(Sc1nnc(C)n1C)C(=O)NN |
| InChI | InChI=1S/C9H17N5OS/c1-4-5-7(8(15)11-10)16-9-13-12-6(2)14(9)3/h7H,4-5,10H2,1-3H3,(H,11,15) |
| InChIKey | AULCATDKCDYFGW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|