C12H13F3N2O3S — CID 83048580
4,4,4-trifluoro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]butane-1-sulfonamide (PubChem CID 83048580) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 83048580 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4,4,4-trifluoro-N-[6-(3-hydroxyprop-1-ynyl)-2-pyridinyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)Nc1cccc(C#CCO)n1 |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)7-3-9-21(19,20)17-11-6-1-4-10(16-11)5-2-8-18/h1,4,6,18H,3,7-9H2,(H,16,17) |
| InChIKey | RDCZONQVJXBNAJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|