About 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine
7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 83048836) has the molecular formula C11H14ClNS
and a molecular weight of 227.76 g/mol. Its IUPAC name is 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine.
Molecular Properties
| Compound Name | 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine |
| PubChem CID | 83048836 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CCCC1Sc2c(Cl)cccc2C1N |
| InChI | InChI=1S/C11H14ClNS/c1-2-4-9-10(13)7-5-3-6-8(12)11(7)14-9/h3,5-6,9-10H,2,4,13H2,1H3 |
| InChIKey | QMBNODORIUHTAQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine?
The IUPAC name of 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine (CID 83048836) is 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine.
What is the SMILES notation for 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine?
The canonical SMILES for 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine is CCCC1Sc2c(Cl)cccc2C1N.
What is the InChIKey of 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine?
The InChIKey is QMBNODORIUHTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNS/c1-2-4-9-10(13)7-5-3-6-8(12)11(7)14-9/h3,5-6,9-10H,2,4,13H2,1H3.
What are the key properties of 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine?
7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine has a molecular weight of 227.76 g/mol, XLogP of 3.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-propyl-2,3-dihydro-1-benzothiophen-3-amine is sourced from PubChem (CID 83048836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).