About 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one
5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one (PubChem CID 83048904) has the molecular formula C13H15ClO2
and a molecular weight of 238.71 g/mol. Its IUPAC name is 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one.
Molecular Properties
| Compound Name | 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one |
| PubChem CID | 83048904 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one |
| SMILES | CCCC1Oc2cc(C)c(Cl)c(C)c2C1=O |
| InChI | InChI=1S/C13H15ClO2/c1-4-5-9-13(15)11-8(3)12(14)7(2)6-10(11)16-9/h6,9H,4-5H2,1-3H3 |
| InChIKey | NJJRMWJIVCBRFZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one?
The IUPAC name of 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one (CID 83048904) is 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one.
What is the SMILES notation for 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one?
The canonical SMILES for 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one is CCCC1Oc2cc(C)c(Cl)c(C)c2C1=O.
What is the InChIKey of 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one?
The InChIKey is NJJRMWJIVCBRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO2/c1-4-5-9-13(15)11-8(3)12(14)7(2)6-10(11)16-9/h6,9H,4-5H2,1-3H3.
What are the key properties of 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one?
5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one has a molecular weight of 238.71 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4,6-dimethyl-2-propyl-1-benzofuran-3-one is sourced from PubChem (CID 83048904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).