C11H12Cl3NO — CID 83048923
4,5,7-trichloro-2-propyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 83048923) has the molecular formula C11H12Cl3NO and a molecular weight of 280.58 g/mol. Its IUPAC name is 4,5,7-trichloro-2-propyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 4,5,7-trichloro-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 83048923 |
| Molecular Formula | C11H12Cl3NO |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 4,5,7-trichloro-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCC1Oc2c(Cl)cc(Cl)c(Cl)c2C1N |
| InChI | InChI=1S/C11H12Cl3NO/c1-2-3-7-10(15)8-9(14)5(12)4-6(13)11(8)16-7/h4,7,10H,2-3,15H2,1H3 |
| InChIKey | RCMBEDSTYGQYGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|