C14H20FNS — CID 83048948
5-fluoro-N,2-dipropyl-2,3-dihydro-1-benzothiophen-3-amine (PubChem CID 83048948) has the molecular formula C14H20FNS and a molecular weight of 253.39 g/mol. Its IUPAC name is 5-fluoro-N,2-dipropyl-2,3-dihydro-1-benzothiophen-3-amine.
| Compound Name | 5-fluoro-N,2-dipropyl-2,3-dihydro-1-benzothiophen-3-amine |
|---|---|
| PubChem CID | 83048948 |
| Molecular Formula | C14H20FNS |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-fluoro-N,2-dipropyl-2,3-dihydro-1-benzothiophen-3-amine |
| SMILES | CCCNC1c2cc(F)ccc2SC1CCC |
| InChI | InChI=1S/C14H20FNS/c1-3-5-13-14(16-8-4-2)11-9-10(15)6-7-12(11)17-13/h6-7,9,13-14,16H,3-5,8H2,1-2H3 |
| InChIKey | QXBUZGQZLLDAMK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |