C15H23NO2 — CID 83049821
5-ethoxy-N-ethyl-2-propyl-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 83049821) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 5-ethoxy-N-ethyl-2-propyl-2,3-dihydro-1-benzofuran-3-amine.
| Compound Name | 5-ethoxy-N-ethyl-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
|---|---|
| PubChem CID | 83049821 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 5-ethoxy-N-ethyl-2-propyl-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCC1Oc2ccc(OCC)cc2C1NCC |
| InChI | InChI=1S/C15H23NO2/c1-4-7-14-15(16-5-2)12-10-11(17-6-3)8-9-13(12)18-14/h8-10,14-16H,4-7H2,1-3H3 |
| InChIKey | YNHKUOULEXRLJH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |