C12H12ClN3S — CID 830512
3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]thiazepine (PubChem CID 830512) has the molecular formula C12H12ClN3S and a molecular weight of 265.77 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]thiazepine.
| Compound Name | 3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]thiazepine |
|---|---|
| PubChem CID | 830512 |
| Molecular Formula | C12H12ClN3S |
| Molecular Weight | 265.77 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 3-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[3,4-b][1,3]thiazepine |
| SMILES | Clc1ccc(-c2nnc3n2CCCCS3)cc1 |
| InChI | InChI=1S/C12H12ClN3S/c13-10-5-3-9(4-6-10)11-14-15-12-16(11)7-1-2-8-17-12/h3-6H,1-2,7-8H2 |
| InChIKey | BDRPVZSUFJNESZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |