[1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine

C16H33N3 — CID 83052147

IUPAC[1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine
SMILESCCCC1CCCCN1C1(CN)CCN(C)C(C)C1
InChIInChI=1S/C16H33N3/c1-4-7-15-8-5-6-10-19(15)16(13-17)9-11-18(3)14(2)12-16/h14-15H,4-13,17H2,1-3H3
InChIKeyJOIYLRSNENMHKF-UHFFFAOYSA-N
MW267.46 g/mol
LogP2.45
Rot. Bonds4

About [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine

[1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine (PubChem CID 83052147) has the molecular formula C16H33N3 and a molecular weight of 267.46 g/mol. Its IUPAC name is [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine.

Molecular Properties

Compound Name[1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine
PubChem CID83052147
Molecular FormulaC16H33N3
Molecular Weight267.46 g/mol
Exact Mass267.27
IUPAC Name[1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine
SMILESCCCC1CCCCN1C1(CN)CCN(C)C(C)C1
InChIInChI=1S/C16H33N3/c1-4-7-15-8-5-6-10-19(15)16(13-17)9-11-18(3)14(2)12-16/h14-15H,4-13,17H2,1-3H3
InChIKeyJOIYLRSNENMHKF-UHFFFAOYSA-N
XLogP2.45
TPSA32.50 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.46
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[3-methyl-1-(2-propylpiperidin-1-yl)cyclobutyl]methanamine
CID 103563116
[1-propan-2-yl-4-(2-propylpiperidin-1-yl)azepan-4-yl]methanamine
CID 83052822
[4-(2-ethylpiperidin-1-yl)-1-methylpiperidin-4-yl]methanamine
CID 43266395
[1,5-dimethyl-3-(2-methylazepan-1-yl)pyrrolidin-3-yl]methanamine
CID 81467694
[1-(2-ethylpyrrolidin-1-yl)-3-methylcyclohexyl]methanamine
CID 60974436
[3,4-dimethyl-1-(2-methylpyrrolidin-1-yl)cyclohexyl]methanamine
CID 64746034
[1-(2-ethylpiperidin-1-yl)-3-(trifluoromethyl)cyclohexyl]methanamine
CID 64758210
[3-(2-ethylazepan-1-yl)oxolan-3-yl]methanamine
CID 104689369
[1-(2-methylpiperidin-1-yl)cyclohexyl]methanamine
CID 24697145
[1-(2-ethylpiperidin-1-yl)-3-(2-methylpropyl)cyclohexyl]methanamine
CID 107428917
[4-(2-ethylazepan-1-yl)thian-4-yl]methanamine
CID 104689235
[1-(2-ethylpiperidin-1-yl)-4-propan-2-ylcyclohexyl]methanamine
CID 63470394

Frequently Asked Questions

What is the IUPAC name of [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine?
The IUPAC name of [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine (CID 83052147) is [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine.
What is the SMILES notation for [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine?
The canonical SMILES for [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine is CCCC1CCCCN1C1(CN)CCN(C)C(C)C1.
What is the InChIKey of [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine?
The InChIKey is JOIYLRSNENMHKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3/c1-4-7-15-8-5-6-10-19(15)16(13-17)9-11-18(3)14(2)12-16/h14-15H,4-13,17H2,1-3H3.
What are the key properties of [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine?
[1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine has a molecular weight of 267.46 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2-dimethyl-4-(2-propylpiperidin-1-yl)piperidin-4-yl]methanamine is sourced from PubChem (CID 83052147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).