C16H22FNO — CID 83056229
1-(3-fluorophenyl)-2-(2-propylpiperidin-1-yl)ethanone (PubChem CID 83056229) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(2-propylpiperidin-1-yl)ethanone.
| Compound Name | 1-(3-fluorophenyl)-2-(2-propylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 83056229 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(2-propylpiperidin-1-yl)ethanone |
| SMILES | CCCC1CCCCN1CC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO/c1-2-6-15-9-3-4-10-18(15)12-16(19)13-7-5-8-14(17)11-13/h5,7-8,11,15H,2-4,6,9-10,12H2,1H3 |
| InChIKey | ZUYAVTFWYFAANP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |