C15H31NS — CID 83057463
3,3-dimethyl-2-[(2-propylpiperidin-1-yl)methyl]butane-1-thiol (PubChem CID 83057463) has the molecular formula C15H31NS and a molecular weight of 257.49 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(2-propylpiperidin-1-yl)methyl]butane-1-thiol.
| Compound Name | 3,3-dimethyl-2-[(2-propylpiperidin-1-yl)methyl]butane-1-thiol |
|---|---|
| PubChem CID | 83057463 |
| Molecular Formula | C15H31NS |
| Molecular Weight | 257.49 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | 3,3-dimethyl-2-[(2-propylpiperidin-1-yl)methyl]butane-1-thiol |
| SMILES | CCCC1CCCCN1CC(CS)C(C)(C)C |
| InChI | InChI=1S/C15H31NS/c1-5-8-14-9-6-7-10-16(14)11-13(12-17)15(2,3)4/h13-14,17H,5-12H2,1-4H3 |
| InChIKey | GCCMXPBEIVBVKD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|