About N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide
N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide (PubChem CID 83057924) has the molecular formula C10H20F3NO3S
and a molecular weight of 291.34 g/mol. Its IUPAC name is N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide.
Molecular Properties
| Compound Name | N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide |
| PubChem CID | 83057924 |
| Molecular Formula | C10H20F3NO3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO3S/c1-4-14(8-9(2,3)15)18(16,17)7-5-6-10(11,12)13/h15H,4-8H2,1-3H3 |
| InChIKey | URASZQAIWSPBBT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide?
The IUPAC name of N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide (CID 83057924) is N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide.
What is the SMILES notation for N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide?
The canonical SMILES for N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide is CCN(CC(C)(C)O)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide?
The InChIKey is URASZQAIWSPBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO3S/c1-4-14(8-9(2,3)15)18(16,17)7-5-6-10(11,12)13/h15H,4-8H2,1-3H3.
What are the key properties of N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide?
N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide has a molecular weight of 291.34 g/mol, XLogP of 1.75, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,4,4-trifluoro-N-(2-hydroxy-2-methylpropyl)butane-1-sulfonamide is sourced from PubChem (CID 83057924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).