C7H12F3N5O2S — CID 83057927
4,4,4-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]butane-1-sulfonamide (PubChem CID 83057927) has the molecular formula C7H12F3N5O2S and a molecular weight of 287.27 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 83057927 |
| Molecular Formula | C7H12F3N5O2S |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4,4,4-trifluoro-N-[1-(2H-tetrazol-5-yl)ethyl]butane-1-sulfonamide |
| SMILES | CC(NS(=O)(=O)CCCC(F)(F)F)c1nn[nH]n1 |
| InChI | InChI=1S/C7H12F3N5O2S/c1-5(6-11-14-15-12-6)13-18(16,17)4-2-3-7(8,9)10/h5,13H,2-4H2,1H3,(H,11,12,14,15) |
| InChIKey | DKEYYGODJDSNBN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |