C9H13F3N2O4S — CID 83058096
3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazine-2,6-dione (PubChem CID 83058096) has the molecular formula C9H13F3N2O4S and a molecular weight of 302.27 g/mol. Its IUPAC name is 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 83058096 |
| Molecular Formula | C9H13F3N2O4S |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O4S/c1-6-8(16)13-7(15)5-14(6)19(17,18)4-2-3-9(10,11)12/h6H,2-5H2,1H3,(H,13,15,16) |
| InChIKey | VAXCRACKWOYUSD-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|