C12H21F3N2O2S — CID 83058103
4-ethyl-5-(4,4,4-trifluorobutylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 83058103) has the molecular formula C12H21F3N2O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is 4-ethyl-5-(4,4,4-trifluorobutylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-ethyl-5-(4,4,4-trifluorobutylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 83058103 |
| Molecular Formula | C12H21F3N2O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-ethyl-5-(4,4,4-trifluorobutylsulfonyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O2S/c1-2-11-10-7-16-6-9(10)8-17(11)20(18,19)5-3-4-12(13,14)15/h9-11,16H,2-8H2,1H3 |
| InChIKey | CSXHZYTXZCNTJR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |