C8H16F3N3O3S — CID 83058107
N'-hydroxy-2-methyl-2-(4,4,4-trifluorobutylsulfonylamino)propanimidamide (PubChem CID 83058107) has the molecular formula C8H16F3N3O3S and a molecular weight of 291.30 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-2-(4,4,4-trifluorobutylsulfonylamino)propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-2-(4,4,4-trifluorobutylsulfonylamino)propanimidamide |
|---|---|
| PubChem CID | 83058107 |
| Molecular Formula | C8H16F3N3O3S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N'-hydroxy-2-methyl-2-(4,4,4-trifluorobutylsulfonylamino)propanimidamide |
| SMILES | CC(C)(NS(=O)(=O)CCCC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C8H16F3N3O3S/c1-7(2,6(12)13-15)14-18(16,17)5-3-4-8(9,10)11/h14-15H,3-5H2,1-2H3,(H2,12,13) |
| InChIKey | IPLMEWOAINYQQC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|