About 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine
2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine (PubChem CID 83058119) has the molecular formula C11H21F3N2O3S
and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine.
Molecular Properties
| Compound Name | 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine |
| PubChem CID | 83058119 |
| Molecular Formula | C11H21F3N2O3S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine |
| SMILES | NCCOC1CCN(S(=O)(=O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2O3S/c12-11(13,14)4-1-9-20(17,18)16-6-2-10(3-7-16)19-8-5-15/h10H,1-9,15H2 |
| InChIKey | NFHJEPMOFPCZAF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine?
The IUPAC name of 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine (CID 83058119) is 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine.
What is the SMILES notation for 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine?
The canonical SMILES for 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine is NCCOC1CCN(S(=O)(=O)CCCC(F)(F)F)CC1.
What is the InChIKey of 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine?
The InChIKey is NFHJEPMOFPCZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2O3S/c12-11(13,14)4-1-9-20(17,18)16-6-2-10(3-7-16)19-8-5-15/h10H,1-9,15H2.
What are the key properties of 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine?
2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine has a molecular weight of 318.36 g/mol, XLogP of 1.10, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-yl]oxyethanamine is sourced from PubChem (CID 83058119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).