About 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide
2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide (PubChem CID 83058220) has the molecular formula C7H13F3N2O2S2
and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide.
Molecular Properties
| Compound Name | 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide |
| PubChem CID | 83058220 |
| Molecular Formula | C7H13F3N2O2S2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide |
| SMILES | CC(NS(=O)(=O)CCCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C7H13F3N2O2S2/c1-5(6(11)15)12-16(13,14)4-2-3-7(8,9)10/h5,12H,2-4H2,1H3,(H2,11,15) |
| InChIKey | NCDFRYIPZHYEAT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide?
The IUPAC name of 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide (CID 83058220) is 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide.
What is the SMILES notation for 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide?
The canonical SMILES for 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide is CC(NS(=O)(=O)CCCC(F)(F)F)C(N)=S.
What is the InChIKey of 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide?
The InChIKey is NCDFRYIPZHYEAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O2S2/c1-5(6(11)15)12-16(13,14)4-2-3-7(8,9)10/h5,12H,2-4H2,1H3,(H2,11,15).
What are the key properties of 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide?
2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide has a molecular weight of 278.32 g/mol, XLogP of 0.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4,4-trifluorobutylsulfonylamino)propanethioamide is sourced from PubChem (CID 83058220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).