About 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine
2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine (PubChem CID 83058383) has the molecular formula C12H21F3N2O2S
and a molecular weight of 314.37 g/mol. Its IUPAC name is 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine.
Molecular Properties
| Compound Name | 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine |
| PubChem CID | 83058383 |
| Molecular Formula | C12H21F3N2O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCCC1C1CCCN1 |
| InChI | InChI=1S/C12H21F3N2O2S/c13-12(14,15)6-3-9-20(18,19)17-8-2-5-11(17)10-4-1-7-16-10/h10-11,16H,1-9H2 |
| InChIKey | UVHGWTVYOQMYQH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine?
The IUPAC name of 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine (CID 83058383) is 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine.
What is the SMILES notation for 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine?
The canonical SMILES for 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine is O=S(=O)(CCCC(F)(F)F)N1CCCC1C1CCCN1.
What is the InChIKey of 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine?
The InChIKey is UVHGWTVYOQMYQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F3N2O2S/c13-12(14,15)6-3-9-20(18,19)17-8-2-5-11(17)10-4-1-7-16-10/h10-11,16H,1-9H2.
What are the key properties of 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine?
2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine has a molecular weight of 314.37 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-2-yl-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine is sourced from PubChem (CID 83058383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).