About 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile
4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile (PubChem CID 83058632) has the molecular formula C11H17F3N2O2S2
and a molecular weight of 330.40 g/mol. Its IUPAC name is 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile |
| PubChem CID | 83058632 |
| Molecular Formula | C11H17F3N2O2S2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile |
| SMILES | CSC1(C#N)CCN(S(=O)(=O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H17F3N2O2S2/c1-19-10(9-15)4-6-16(7-5-10)20(17,18)8-2-3-11(12,13)14/h2-8H2,1H3 |
| InChIKey | YUXCKMUHQVCJFM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile?
The IUPAC name of 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile (CID 83058632) is 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile.
What is the SMILES notation for 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile?
The canonical SMILES for 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile is CSC1(C#N)CCN(S(=O)(=O)CCCC(F)(F)F)CC1.
What is the InChIKey of 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile?
The InChIKey is YUXCKMUHQVCJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O2S2/c1-19-10(9-15)4-6-16(7-5-10)20(17,18)8-2-3-11(12,13)14/h2-8H2,1H3.
What are the key properties of 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile?
4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile has a molecular weight of 330.40 g/mol, XLogP of 2.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-1-(4,4,4-trifluorobutylsulfonyl)piperidine-4-carbonitrile is sourced from PubChem (CID 83058632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).