About 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide
1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide (PubChem CID 83058634) has the molecular formula C9H15F3N2O2S2
and a molecular weight of 304.36 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide.
Molecular Properties
| Compound Name | 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide |
| PubChem CID | 83058634 |
| Molecular Formula | C9H15F3N2O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide |
| SMILES | NC(=S)C1CCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2S2/c10-9(11,12)4-2-6-18(15,16)14-5-1-3-7(14)8(13)17/h7H,1-6H2,(H2,13,17) |
| InChIKey | UFVXGNFIBPHWPS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide?
The IUPAC name of 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide (CID 83058634) is 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide.
What is the SMILES notation for 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide?
The canonical SMILES for 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide is NC(=S)C1CCCN1S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide?
The InChIKey is UFVXGNFIBPHWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O2S2/c10-9(11,12)4-2-6-18(15,16)14-5-1-3-7(14)8(13)17/h7H,1-6H2,(H2,13,17).
What are the key properties of 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide?
1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide has a molecular weight of 304.36 g/mol, XLogP of 1.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4,4-trifluorobutylsulfonyl)pyrrolidine-2-carbothioamide is sourced from PubChem (CID 83058634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).