About 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane
2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane (PubChem CID 83058639) has the molecular formula C11H17F3N2O3S
and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane.
Molecular Properties
| Compound Name | 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane |
| PubChem CID | 83058639 |
| Molecular Formula | C11H17F3N2O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane |
| SMILES | O=C=NC1CCCCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H17F3N2O3S/c12-11(13,14)6-4-8-20(18,19)16-7-3-1-2-5-10(16)15-9-17/h10H,1-8H2 |
| InChIKey | FFIHYXDSPMYEEP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane?
The IUPAC name of 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane (CID 83058639) is 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane.
What is the SMILES notation for 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane?
The canonical SMILES for 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane is O=C=NC1CCCCCN1S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane?
The InChIKey is FFIHYXDSPMYEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N2O3S/c12-11(13,14)6-4-8-20(18,19)16-7-3-1-2-5-10(16)15-9-17/h10H,1-8H2.
What are the key properties of 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane?
2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane has a molecular weight of 314.33 g/mol, XLogP of 2.20, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanato-1-(4,4,4-trifluorobutylsulfonyl)azepane is sourced from PubChem (CID 83058639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).