About 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol
3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol (PubChem CID 83058647) has the molecular formula C10H18F3NO3S
and a molecular weight of 289.32 g/mol. Its IUPAC name is 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol.
Molecular Properties
| Compound Name | 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol |
| PubChem CID | 83058647 |
| Molecular Formula | C10H18F3NO3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol |
| SMILES | CCCC1(O)CN(S(=O)(=O)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3NO3S/c1-2-4-9(15)7-14(8-9)18(16,17)6-3-5-10(11,12)13/h15H,2-8H2,1H3 |
| InChIKey | CGXMASQGPIUAIT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol?
The IUPAC name of 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol (CID 83058647) is 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol.
What is the SMILES notation for 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol?
The canonical SMILES for 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol is CCCC1(O)CN(S(=O)(=O)CCCC(F)(F)F)C1.
What is the InChIKey of 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol?
The InChIKey is CGXMASQGPIUAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO3S/c1-2-4-9(15)7-14(8-9)18(16,17)6-3-5-10(11,12)13/h15H,2-8H2,1H3.
What are the key properties of 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol?
3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol has a molecular weight of 289.32 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-ol is sourced from PubChem (CID 83058647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).