C11H21F3N2O2S — CID 83058659
N,4-dimethyl-1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-amine (PubChem CID 83058659) has the molecular formula C11H21F3N2O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N,4-dimethyl-1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-amine.
| Compound Name | N,4-dimethyl-1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 83058659 |
| Molecular Formula | C11H21F3N2O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N,4-dimethyl-1-(4,4,4-trifluorobutylsulfonyl)piperidin-4-amine |
| SMILES | CNC1(C)CCN(S(=O)(=O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H21F3N2O2S/c1-10(15-2)5-7-16(8-6-10)19(17,18)9-3-4-11(12,13)14/h15H,3-9H2,1-2H3 |
| InChIKey | GFYSKSKOOGPXMT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |