About 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide
2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide (PubChem CID 83058675) has the molecular formula C10H19F3N4O2S
and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide.
Molecular Properties
| Compound Name | 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide |
| PubChem CID | 83058675 |
| Molecular Formula | C10H19F3N4O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CN1CCN(S(=O)(=O)CCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N4O2S/c11-10(12,13)2-1-7-20(18,19)17-5-3-16(4-6-17)8-9(14)15/h1-8H2,(H3,14,15) |
| InChIKey | VRJVZWCCKJMBMC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide?
The IUPAC name of 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide (CID 83058675) is 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide.
What is the SMILES notation for 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide?
The canonical SMILES for 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide is [H]/N=C(\N)CN1CCN(S(=O)(=O)CCCC(F)(F)F)CC1.
What is the InChIKey of 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide?
The InChIKey is VRJVZWCCKJMBMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N4O2S/c11-10(12,13)2-1-7-20(18,19)17-5-3-16(4-6-17)8-9(14)15/h1-8H2,(H3,14,15).
What are the key properties of 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide?
2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide has a molecular weight of 316.35 g/mol, XLogP of 0.21, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4,4,4-trifluorobutylsulfonyl)piperazin-1-yl]ethanimidamide is sourced from PubChem (CID 83058675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).