About 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one
3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one (PubChem CID 83058791) has the molecular formula C9H15F3N2O3S
and a molecular weight of 288.29 g/mol. Its IUPAC name is 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one.
Molecular Properties
| Compound Name | 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one |
| PubChem CID | 83058791 |
| Molecular Formula | C9H15F3N2O3S |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one |
| SMILES | CC1C(=O)NCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O3S/c1-7-8(15)13-4-5-14(7)18(16,17)6-2-3-9(10,11)12/h7H,2-6H2,1H3,(H,13,15) |
| InChIKey | ZJZWZVUKIRGJFG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one?
The IUPAC name of 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one (CID 83058791) is 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one.
What is the SMILES notation for 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one?
The canonical SMILES for 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one is CC1C(=O)NCCN1S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one?
The InChIKey is ZJZWZVUKIRGJFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O3S/c1-7-8(15)13-4-5-14(7)18(16,17)6-2-3-9(10,11)12/h7H,2-6H2,1H3,(H,13,15).
What are the key properties of 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one?
3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one has a molecular weight of 288.29 g/mol, XLogP of 0.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(4,4,4-trifluorobutylsulfonyl)piperazin-2-one is sourced from PubChem (CID 83058791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).