C9H18F3N3O3S — CID 83058806
N'-hydroxy-2-methyl-3-[methyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide (PubChem CID 83058806) has the molecular formula C9H18F3N3O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-[methyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-[methyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide |
|---|---|
| PubChem CID | 83058806 |
| Molecular Formula | C9H18F3N3O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N'-hydroxy-2-methyl-3-[methyl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide |
| SMILES | CC(CN(C)S(=O)(=O)CCCC(F)(F)F)C(N)=NO |
| InChI | InChI=1S/C9H18F3N3O3S/c1-7(8(13)14-16)6-15(2)19(17,18)5-3-4-9(10,11)12/h7,16H,3-6H2,1-2H3,(H2,13,14) |
| InChIKey | MMBVFODHFIDVNY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|