C10H17F3N2O2S — CID 83058924
(3aS,6aS)-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole (PubChem CID 83058924) has the molecular formula C10H17F3N2O2S and a molecular weight of 286.32 g/mol. Its IUPAC name is (3aS,6aS)-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole.
| Compound Name | (3aS,6aS)-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 83058924 |
| Molecular Formula | C10H17F3N2O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | (3aS,6aS)-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,4-b]pyrrole |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C10H17F3N2O2S/c11-10(12,13)3-1-5-18(16,17)15-4-2-8-6-14-7-9(8)15/h8-9,14H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | YQVNBDLMUFCLMC-DTWKUNHWSA-N |
| XLogP | 0.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |