C10H20F3N3O3S — CID 83058936
N'-hydroxy-3-[propan-2-yl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide (PubChem CID 83058936) has the molecular formula C10H20F3N3O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is N'-hydroxy-3-[propan-2-yl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[propan-2-yl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide |
|---|---|
| PubChem CID | 83058936 |
| Molecular Formula | C10H20F3N3O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N'-hydroxy-3-[propan-2-yl(4,4,4-trifluorobutylsulfonyl)amino]propanimidamide |
| SMILES | CC(C)N(CCC(N)=NO)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H20F3N3O3S/c1-8(2)16(6-4-9(14)15-17)20(18,19)7-3-5-10(11,12)13/h8,17H,3-7H2,1-2H3,(H2,14,15) |
| InChIKey | ANZJCZPNRNAFQY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|