About N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide
N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide (PubChem CID 83058943) has the molecular formula C10H19BrF3NO2S
and a molecular weight of 354.23 g/mol. Its IUPAC name is N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide |
| PubChem CID | 83058943 |
| Molecular Formula | C10H19BrF3NO2S |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide |
| SMILES | CC(C)N(CCCBr)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H19BrF3NO2S/c1-9(2)15(7-4-6-11)18(16,17)8-3-5-10(12,13)14/h9H,3-8H2,1-2H3 |
| InChIKey | DSMPYCMBDVPXJW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide?
The IUPAC name of N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide (CID 83058943) is N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide.
What is the SMILES notation for N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide?
The canonical SMILES for N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide is CC(C)N(CCCBr)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide?
The InChIKey is DSMPYCMBDVPXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19BrF3NO2S/c1-9(2)15(7-4-6-11)18(16,17)8-3-5-10(12,13)14/h9H,3-8H2,1-2H3.
What are the key properties of N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide?
N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide has a molecular weight of 354.23 g/mol, XLogP of 3.15, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-bromopropyl)-4,4,4-trifluoro-N-propan-2-ylbutane-1-sulfonamide is sourced from PubChem (CID 83058943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).