About 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide
3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide (PubChem CID 83059113) has the molecular formula C10H18F3N3O3S
and a molecular weight of 317.33 g/mol. Its IUPAC name is 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide |
| PubChem CID | 83059113 |
| Molecular Formula | C10H18F3N3O3S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide |
| SMILES | NC(CCN(C1CC1)S(=O)(=O)CCCC(F)(F)F)=NO |
| InChI | InChI=1S/C10H18F3N3O3S/c11-10(12,13)5-1-7-20(18,19)16(8-2-3-8)6-4-9(14)15-17/h8,17H,1-7H2,(H2,14,15) |
| InChIKey | YTDAEIXJGOSIMB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide?
The IUPAC name of 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide (CID 83059113) is 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide.
What is the SMILES notation for 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide?
The canonical SMILES for 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide is NC(CCN(C1CC1)S(=O)(=O)CCCC(F)(F)F)=NO.
What is the InChIKey of 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide?
The InChIKey is YTDAEIXJGOSIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3N3O3S/c11-10(12,13)5-1-7-20(18,19)16(8-2-3-8)6-4-9(14)15-17/h8,17H,1-7H2,(H2,14,15).
What are the key properties of 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide?
3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide has a molecular weight of 317.33 g/mol, XLogP of 1.26, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(4,4,4-trifluorobutylsulfonyl)amino]-N'-hydroxypropanimidamide is sourced from PubChem (CID 83059113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).