About 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide
3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide (PubChem CID 83059256) has the molecular formula C9H17F3N2O2S2
and a molecular weight of 306.38 g/mol. Its IUPAC name is 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide.
Molecular Properties
| Compound Name | 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide |
| PubChem CID | 83059256 |
| Molecular Formula | C9H17F3N2O2S2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide |
| SMILES | CCN(CCC(N)=S)S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2S2/c1-2-14(6-4-8(13)17)18(15,16)7-3-5-9(10,11)12/h2-7H2,1H3,(H2,13,17) |
| InChIKey | HDBGCDQBGFKQJS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide?
The IUPAC name of 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide (CID 83059256) is 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide.
What is the SMILES notation for 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide?
The canonical SMILES for 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide is CCN(CCC(N)=S)S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide?
The InChIKey is HDBGCDQBGFKQJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2S2/c1-2-14(6-4-8(13)17)18(15,16)7-3-5-9(10,11)12/h2-7H2,1H3,(H2,13,17).
What are the key properties of 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide?
3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide has a molecular weight of 306.38 g/mol, XLogP of 1.66, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethyl(4,4,4-trifluorobutylsulfonyl)amino]propanethioamide is sourced from PubChem (CID 83059256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).