C11H19F3N2O2S — CID 83059275
2-methyl-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole (PubChem CID 83059275) has the molecular formula C11H19F3N2O2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-methyl-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole.
| Compound Name | 2-methyl-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 83059275 |
| Molecular Formula | C11H19F3N2O2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-methyl-1-(4,4,4-trifluorobutylsulfonyl)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole |
| SMILES | CC1CC2CNCC2N1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2S/c1-8-5-9-6-15-7-10(9)16(8)19(17,18)4-2-3-11(12,13)14/h8-10,15H,2-7H2,1H3 |
| InChIKey | VUONKSYZJGAWJX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |