C8H14Cl2F3NO2S — CID 83059299
N-(1,3-dichloro-2-methylpropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83059299) has the molecular formula C8H14Cl2F3NO2S and a molecular weight of 316.17 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83059299 |
| Molecular Formula | C8H14Cl2F3NO2S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(CCl)(CCl)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H14Cl2F3NO2S/c1-7(5-9,6-10)14-17(15,16)4-2-3-8(11,12)13/h14H,2-6H2,1H3 |
| InChIKey | JZNLNLNDGOLGQM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|