C11H17F3N2O2S — CID 83059396
N-(1-cyanocyclohexyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83059396) has the molecular formula C11H17F3N2O2S and a molecular weight of 298.33 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(1-cyanocyclohexyl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83059396 |
| Molecular Formula | C11H17F3N2O2S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(1-cyanocyclohexyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | N#CC1(NS(=O)(=O)CCCC(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C11H17F3N2O2S/c12-11(13,14)7-4-8-19(17,18)16-10(9-15)5-2-1-3-6-10/h16H,1-8H2 |
| InChIKey | LYKMLDHBZIVMOJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |