C9H15F3N4O2S — CID 83059718
4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butane-1-sulfonamide (PubChem CID 83059718) has the molecular formula C9H15F3N4O2S and a molecular weight of 300.31 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 83059718 |
| Molecular Formula | C9H15F3N4O2S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 4,4,4-trifluoro-N-[3-(1H-1,2,4-triazol-5-yl)propyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C9H15F3N4O2S/c10-9(11,12)4-2-6-19(17,18)15-5-1-3-8-13-7-14-16-8/h7,15H,1-6H2,(H,13,14,16) |
| InChIKey | LTLRKCDJFIEGNH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|