About N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide
N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide (PubChem CID 83059730) has the molecular formula C7H14F3N3O3S
and a molecular weight of 277.27 g/mol. Its IUPAC name is N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide.
Molecular Properties
| Compound Name | N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide |
| PubChem CID | 83059730 |
| Molecular Formula | C7H14F3N3O3S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide |
| SMILES | NC(CCNS(=O)(=O)CCCC(F)(F)F)=NO |
| InChI | InChI=1S/C7H14F3N3O3S/c8-7(9,10)3-1-5-17(15,16)12-4-2-6(11)13-14/h12,14H,1-5H2,(H2,11,13) |
| InChIKey | PQBNMQTYOOWCPP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide?
The IUPAC name of N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide (CID 83059730) is N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide.
What is the SMILES notation for N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide?
The canonical SMILES for N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide is NC(CCNS(=O)(=O)CCCC(F)(F)F)=NO.
What is the InChIKey of N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide?
The InChIKey is PQBNMQTYOOWCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F3N3O3S/c8-7(9,10)3-1-5-17(15,16)12-4-2-6(11)13-14/h12,14H,1-5H2,(H2,11,13).
What are the key properties of N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide?
N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide has a molecular weight of 277.27 g/mol, XLogP of 0.38, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-3-(4,4,4-trifluorobutylsulfonylamino)propanimidamide is sourced from PubChem (CID 83059730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).