About 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine
4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine (PubChem CID 83059738) has the molecular formula C11H19ClF3NO3S
and a molecular weight of 337.79 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine.
Molecular Properties
| Compound Name | 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine |
| PubChem CID | 83059738 |
| Molecular Formula | C11H19ClF3NO3S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCC(OCCCl)CC1 |
| InChI | InChI=1S/C11H19ClF3NO3S/c12-5-8-19-10-2-6-16(7-3-10)20(17,18)9-1-4-11(13,14)15/h10H,1-9H2 |
| InChIKey | JVBCBTWKVGTYBB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine?
The IUPAC name of 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine (CID 83059738) is 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine.
What is the SMILES notation for 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine?
The canonical SMILES for 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine is O=S(=O)(CCCC(F)(F)F)N1CCC(OCCCl)CC1.
What is the InChIKey of 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine?
The InChIKey is JVBCBTWKVGTYBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClF3NO3S/c12-5-8-19-10-2-6-16(7-3-10)20(17,18)9-1-4-11(13,14)15/h10H,1-9H2.
What are the key properties of 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine?
4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine has a molecular weight of 337.79 g/mol, XLogP of 2.38, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethoxy)-1-(4,4,4-trifluorobutylsulfonyl)piperidine is sourced from PubChem (CID 83059738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).