C8H11F3N4O2S2 — CID 83059836
5-(4,4,4-trifluorobutylsulfonylamino)-1H-pyrazole-4-carbothioamide (PubChem CID 83059836) has the molecular formula C8H11F3N4O2S2 and a molecular weight of 316.33 g/mol. Its IUPAC name is 5-(4,4,4-trifluorobutylsulfonylamino)-1H-pyrazole-4-carbothioamide.
| Compound Name | 5-(4,4,4-trifluorobutylsulfonylamino)-1H-pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 83059836 |
| Molecular Formula | C8H11F3N4O2S2 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 5-(4,4,4-trifluorobutylsulfonylamino)-1H-pyrazole-4-carbothioamide |
| SMILES | NC(=S)c1cn[nH]c1NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O2S2/c9-8(10,11)2-1-3-19(16,17)15-7-5(6(12)18)4-13-14-7/h4H,1-3H2,(H2,12,18)(H2,13,14,15) |
| InChIKey | HRYKJQHWJIPZPB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|