About [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol
[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol (PubChem CID 83059844) has the molecular formula C9H16F3NO3S
and a molecular weight of 275.29 g/mol. Its IUPAC name is [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol |
| PubChem CID | 83059844 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCC(CO)C1 |
| InChI | InChI=1S/C9H16F3NO3S/c10-9(11,12)3-1-5-17(15,16)13-4-2-8(6-13)7-14/h8,14H,1-7H2 |
| InChIKey | MDFLSZGBJTXRRB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol?
The IUPAC name of [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol (CID 83059844) is [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol.
What is the SMILES notation for [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol?
The canonical SMILES for [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol is O=S(=O)(CCCC(F)(F)F)N1CCC(CO)C1.
What is the InChIKey of [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol?
The InChIKey is MDFLSZGBJTXRRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F3NO3S/c10-9(11,12)3-1-5-17(15,16)13-4-2-8(6-13)7-14/h8,14H,1-7H2.
What are the key properties of [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol?
[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol has a molecular weight of 275.29 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-yl]methanol is sourced from PubChem (CID 83059844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).