About (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol
(3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol (PubChem CID 83059847) has the molecular formula C8H14F3NO3S
and a molecular weight of 261.26 g/mol. Its IUPAC name is (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol |
| PubChem CID | 83059847 |
| Molecular Formula | C8H14F3NO3S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C8H14F3NO3S/c9-8(10,11)3-1-5-16(14,15)12-4-2-7(13)6-12/h7,13H,1-6H2/t7-/m1/s1 |
| InChIKey | OQFUGWKAPZZWAT-SSDOTTSWSA-N |
| XLogP | 0.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol?
The IUPAC name of (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol (CID 83059847) is (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol.
What is the SMILES notation for (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol?
The canonical SMILES for (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol is O=S(=O)(CCCC(F)(F)F)N1CC[C@@H](O)C1.
What is the InChIKey of (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol?
The InChIKey is OQFUGWKAPZZWAT-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14F3NO3S/c9-8(10,11)3-1-5-16(14,15)12-4-2-7(13)6-12/h7,13H,1-6H2/t7-/m1/s1.
What are the key properties of (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol?
(3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol has a molecular weight of 261.26 g/mol, XLogP of 0.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-3-ol is sourced from PubChem (CID 83059847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).