About 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol
1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol (PubChem CID 83059849) has the molecular formula C12H22F3NO3S
and a molecular weight of 317.37 g/mol. Its IUPAC name is 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol.
Molecular Properties
| Compound Name | 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol |
| PubChem CID | 83059849 |
| Molecular Formula | C12H22F3NO3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol |
| SMILES | CC(O)CC1CCCCN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H22F3NO3S/c1-10(17)9-11-5-2-3-7-16(11)20(18,19)8-4-6-12(13,14)15/h10-11,17H,2-9H2,1H3 |
| InChIKey | QDAYPJZMOVDNLG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol?
The IUPAC name of 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol (CID 83059849) is 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol.
What is the SMILES notation for 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol?
The canonical SMILES for 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol is CC(O)CC1CCCCN1S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol?
The InChIKey is QDAYPJZMOVDNLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO3S/c1-10(17)9-11-5-2-3-7-16(11)20(18,19)8-4-6-12(13,14)15/h10-11,17H,2-9H2,1H3.
What are the key properties of 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol?
1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol has a molecular weight of 317.37 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(4,4,4-trifluorobutylsulfonyl)piperidin-2-yl]propan-2-ol is sourced from PubChem (CID 83059849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).