About 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide
3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide (PubChem CID 83059977) has the molecular formula C8H15F3N2O2S2
and a molecular weight of 292.35 g/mol. Its IUPAC name is 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide.
Molecular Properties
| Compound Name | 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide |
| PubChem CID | 83059977 |
| Molecular Formula | C8H15F3N2O2S2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide |
| SMILES | CC(CC(N)=S)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2S2/c1-6(5-7(12)16)13-17(14,15)4-2-3-8(9,10)11/h6,13H,2-5H2,1H3,(H2,12,16) |
| InChIKey | STJGTBPERFJFDE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide?
The IUPAC name of 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide (CID 83059977) is 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide.
What is the SMILES notation for 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide?
The canonical SMILES for 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide is CC(CC(N)=S)NS(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide?
The InChIKey is STJGTBPERFJFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O2S2/c1-6(5-7(12)16)13-17(14,15)4-2-3-8(9,10)11/h6,13H,2-5H2,1H3,(H2,12,16).
What are the key properties of 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide?
3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide has a molecular weight of 292.35 g/mol, XLogP of 1.31, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4,4-trifluorobutylsulfonylamino)butanethioamide is sourced from PubChem (CID 83059977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).