C12H23F3N2O2S — CID 83059996
2,5-diethyl-1-(4,4,4-trifluorobutylsulfonyl)piperazine (PubChem CID 83059996) has the molecular formula C12H23F3N2O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is 2,5-diethyl-1-(4,4,4-trifluorobutylsulfonyl)piperazine.
| Compound Name | 2,5-diethyl-1-(4,4,4-trifluorobutylsulfonyl)piperazine |
|---|---|
| PubChem CID | 83059996 |
| Molecular Formula | C12H23F3N2O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2,5-diethyl-1-(4,4,4-trifluorobutylsulfonyl)piperazine |
| SMILES | CCC1CN(S(=O)(=O)CCCC(F)(F)F)C(CC)CN1 |
| InChI | InChI=1S/C12H23F3N2O2S/c1-3-10-9-17(11(4-2)8-16-10)20(18,19)7-5-6-12(13,14)15/h10-11,16H,3-9H2,1-2H3 |
| InChIKey | SBNVPKUXRLNFTC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |