About [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine
[5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine (PubChem CID 83060013) has the molecular formula C10H19F3N2O3S
and a molecular weight of 304.33 g/mol. Its IUPAC name is [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine |
| PubChem CID | 83060013 |
| Molecular Formula | C10H19F3N2O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine |
| SMILES | CC1COC(CN)CN1S(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O3S/c1-8-7-18-9(5-14)6-15(8)19(16,17)4-2-3-10(11,12)13/h8-9H,2-7,14H2,1H3 |
| InChIKey | JXEBFURHQHQYOF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine?
The IUPAC name of [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine (CID 83060013) is [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine.
What is the SMILES notation for [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine?
The canonical SMILES for [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine is CC1COC(CN)CN1S(=O)(=O)CCCC(F)(F)F.
What is the InChIKey of [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine?
The InChIKey is JXEBFURHQHQYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O3S/c1-8-7-18-9(5-14)6-15(8)19(16,17)4-2-3-10(11,12)13/h8-9H,2-7,14H2,1H3.
What are the key properties of [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine?
[5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine has a molecular weight of 304.33 g/mol, XLogP of 0.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-4-(4,4,4-trifluorobutylsulfonyl)morpholin-2-yl]methanamine is sourced from PubChem (CID 83060013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).