About 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol
3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol (PubChem CID 83060125) has the molecular formula C11H20F3NO3S
and a molecular weight of 303.35 g/mol. Its IUPAC name is 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol |
| PubChem CID | 83060125 |
| Molecular Formula | C11H20F3NO3S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCCC1CCCO |
| InChI | InChI=1S/C11H20F3NO3S/c12-11(13,14)6-3-9-19(17,18)15-7-1-4-10(15)5-2-8-16/h10,16H,1-9H2 |
| InChIKey | PLKQAJZTOOSEIL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol?
The IUPAC name of 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol (CID 83060125) is 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol.
What is the SMILES notation for 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol?
The canonical SMILES for 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol is O=S(=O)(CCCC(F)(F)F)N1CCCC1CCCO.
What is the InChIKey of 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol?
The InChIKey is PLKQAJZTOOSEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO3S/c12-11(13,14)6-3-9-19(17,18)15-7-1-4-10(15)5-2-8-16/h10,16H,1-9H2.
What are the key properties of 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol?
3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol has a molecular weight of 303.35 g/mol, XLogP of 1.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(4,4,4-trifluorobutylsulfonyl)pyrrolidin-2-yl]propan-1-ol is sourced from PubChem (CID 83060125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).