About 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine
4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine (PubChem CID 83060957) has the molecular formula C15H21N3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine.
Molecular Properties
| Compound Name | 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine |
| PubChem CID | 83060957 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine |
| SMILES | CCC(CC)N(C)c1ccnc2c(N)cccc12 |
| InChI | InChI=1S/C15H21N3/c1-4-11(5-2)18(3)14-9-10-17-15-12(14)7-6-8-13(15)16/h6-11H,4-5,16H2,1-3H3 |
| InChIKey | NWTMSUJIGDMOEX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine?
The IUPAC name of 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine (CID 83060957) is 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine.
What is the SMILES notation for 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine?
The canonical SMILES for 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine is CCC(CC)N(C)c1ccnc2c(N)cccc12.
What is the InChIKey of 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine?
The InChIKey is NWTMSUJIGDMOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3/c1-4-11(5-2)18(3)14-9-10-17-15-12(14)7-6-8-13(15)16/h6-11H,4-5,16H2,1-3H3.
What are the key properties of 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine?
4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine has a molecular weight of 243.35 g/mol, XLogP of 3.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-4-N-pentan-3-ylquinoline-4,8-diamine is sourced from PubChem (CID 83060957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).